C21H21N7O2 — CID 70235307
N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-pent-3-ynoxypyrazine-2-carboxamide (PubChem CID 70235307) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-pent-3-ynoxypyrazine-2-carboxamide.
| Compound Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-pent-3-ynoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70235307 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-pent-3-ynoxypyrazine-2-carboxamide |
| SMILES | CC#CCCOc1cnc(C(=O)Nc2ccnc(CNc3cccnc3N)c2)cn1 |
| InChI | InChI=1S/C21H21N7O2/c1-2-3-4-10-30-19-14-26-18(13-27-19)21(29)28-15-7-9-23-16(11-15)12-25-17-6-5-8-24-20(17)22/h5-9,11,13-14,25H,4,10,12H2,1H3,(H2,22,24)(H,23,28,29) |
| InChIKey | PODQDAASNYXCOO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|