C21H23N7O2 — CID 143980568
N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-but-3-ynoxy-5-methylpyrazine (PubChem CID 143980568) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-but-3-ynoxy-5-methylpyrazine.
| Compound Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-but-3-ynoxy-5-methylpyrazine |
|---|---|
| PubChem CID | 143980568 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-but-3-ynoxy-5-methylpyrazine |
| SMILES | C#CCCOc1cnc(C)cn1.Nc1ncccc1NCc1cc(NC=O)ccn1 |
| InChI | InChI=1S/C12H13N5O.C9H10N2O/c13-12-11(2-1-4-15-12)16-7-10-6-9(17-8-18)3-5-14-10;1-3-4-5-12-9-7-10-8(2)6-11-9/h1-6,8,16H,7H2,(H2,13,15)(H,14,17,18);1,6-7H,4-5H2,2H3 |
| InChIKey | YKNNPEZLSGXQPE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|