C22H22ClFN6O2 — CID 143980576
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]formamide;2-(4-chlorobut-2-ynoxy)-5-methylpyrazine (PubChem CID 143980576) has the molecular formula C22H22ClFN6O2 and a molecular weight of 456.91 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]formamide;2-(4-chlorobut-2-ynoxy)-5-methylpyrazine.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]formamide;2-(4-chlorobut-2-ynoxy)-5-methylpyrazine |
|---|---|
| PubChem CID | 143980576 |
| Molecular Formula | C22H22ClFN6O2 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]formamide;2-(4-chlorobut-2-ynoxy)-5-methylpyrazine |
| SMILES | Cc1cnc(OCC#CCCl)cn1.Nc1ncccc1NCc1cc(NC=O)ccc1F |
| InChI | InChI=1S/C13H13FN4O.C9H9ClN2O/c14-11-4-3-10(18-8-19)6-9(11)7-17-12-2-1-5-16-13(12)15;1-8-6-12-9(7-11-8)13-5-3-2-4-10/h1-6,8,17H,7H2,(H2,15,16)(H,18,19);6-7H,4-5H2,1H3 |
| InChIKey | ZPZCMTHJVJADCW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|