C21H25N7O2 — CID 143980591
N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-methyl-5-(2-methylprop-2-enoxy)pyrazine (PubChem CID 143980591) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-methyl-5-(2-methylprop-2-enoxy)pyrazine.
| Compound Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-methyl-5-(2-methylprop-2-enoxy)pyrazine |
|---|---|
| PubChem CID | 143980591 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]formamide;2-methyl-5-(2-methylprop-2-enoxy)pyrazine |
| SMILES | C=C(C)COc1cnc(C)cn1.Nc1ncccc1NCc1cc(NC=O)ccn1 |
| InChI | InChI=1S/C12H13N5O.C9H12N2O/c13-12-11(2-1-4-15-12)16-7-10-6-9(17-8-18)3-5-14-10;1-7(2)6-12-9-5-10-8(3)4-11-9/h1-6,8,16H,7H2,(H2,13,15)(H,14,17,18);4-5H,1,6H2,2-3H3 |
| InChIKey | APMSSNOPKXEFAT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|