C18H17FN4O2 — CID 45381482
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-3-methylfuran-2-carboxamide (PubChem CID 45381482) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 45381482 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1ccc(F)c(CNc2cccnc2N)c1 |
| InChI | InChI=1S/C18H17FN4O2/c1-11-6-8-25-16(11)18(24)23-13-4-5-14(19)12(9-13)10-22-15-3-2-7-21-17(15)20/h2-9,22H,10H2,1H3,(H2,20,21)(H,23,24) |
| InChIKey | RNXCQDRZEDGPDC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |