C22H21FN6O3 — CID 70235180
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(4-methoxybut-2-ynoxy)pyrazine-2-carboxamide (PubChem CID 70235180) has the molecular formula C22H21FN6O3 and a molecular weight of 436.45 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(4-methoxybut-2-ynoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(4-methoxybut-2-ynoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70235180 |
| Molecular Formula | C22H21FN6O3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(4-methoxybut-2-ynoxy)pyrazine-2-carboxamide |
| SMILES | COCC#CCOc1cnc(C(=O)Nc2ccc(F)c(CNc3cccnc3N)c2)cn1 |
| InChI | InChI=1S/C22H21FN6O3/c1-31-9-2-3-10-32-20-14-27-19(13-28-20)22(30)29-16-6-7-17(23)15(11-16)12-26-18-5-4-8-25-21(18)24/h4-8,11,13-14,26H,9-10,12H2,1H3,(H2,24,25)(H,29,30) |
| InChIKey | BTMNYKQSQJJGHZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|