C20H23N7O3 — CID 70234102
N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide (PubChem CID 70234102) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70234102 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide |
| SMILES | CCOCCOc1cnc(C(=O)Nc2ccnc(CNc3cccnc3N)c2)cn1 |
| InChI | InChI=1S/C20H23N7O3/c1-2-29-8-9-30-18-13-25-17(12-26-18)20(28)27-14-5-7-22-15(10-14)11-24-16-4-3-6-23-19(16)21/h3-7,10,12-13,24H,2,8-9,11H2,1H3,(H2,21,23)(H,22,27,28) |
| InChIKey | HNFLEBLBCVKBFE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|