C18H21FN4O3 — CID 139564255
[(3R)-4-fluoro-3-[3-[(5-methoxypyridine-2-carbonyl)amino]phenyl]butyl] carbamimidate (PubChem CID 139564255) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is [(3R)-4-fluoro-3-[3-[(5-methoxypyridine-2-carbonyl)amino]phenyl]butyl] carbamimidate.
| Compound Name | [(3R)-4-fluoro-3-[3-[(5-methoxypyridine-2-carbonyl)amino]phenyl]butyl] carbamimidate |
|---|---|
| PubChem CID | 139564255 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(3R)-4-fluoro-3-[3-[(5-methoxypyridine-2-carbonyl)amino]phenyl]butyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC[C@@H](CF)c1cccc(NC(=O)c2ccc(OC)cn2)c1 |
| InChI | InChI=1S/C18H21FN4O3/c1-25-15-5-6-16(22-11-15)17(24)23-14-4-2-3-12(9-14)13(10-19)7-8-26-18(20)21/h2-6,9,11,13H,7-8,10H2,1H3,(H3,20,21)(H,23,24)/t13-/m0/s1 |
| InChIKey | JBHSFHDOBGLVHG-ZDUSSCGKSA-N |
| XLogP | 2.70 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|