C19H18F3N5O3 — CID 144693176
[(3R)-3-[2,3-difluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-4-fluorobutyl] carbamimidate (PubChem CID 144693176) has the molecular formula C19H18F3N5O3 and a molecular weight of 421.38 g/mol. Its IUPAC name is [(3R)-3-[2,3-difluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-4-fluorobutyl] carbamimidate.
| Compound Name | [(3R)-3-[2,3-difluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-4-fluorobutyl] carbamimidate |
|---|---|
| PubChem CID | 144693176 |
| Molecular Formula | C19H18F3N5O3 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [(3R)-3-[2,3-difluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-4-fluorobutyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC[C@@H](CF)c1cc(NC(=O)c2cnc(OCC#C)cn2)cc(F)c1F |
| InChI | InChI=1S/C19H18F3N5O3/c1-2-4-29-16-10-25-15(9-26-16)18(28)27-12-6-13(17(22)14(21)7-12)11(8-20)3-5-30-19(23)24/h1,6-7,9-11H,3-5,8H2,(H3,23,24)(H,27,28)/t11-/m0/s1 |
| InChIKey | MFFAKDZVWIKWTI-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|