C21H21F4N5O3S — CID 130434903
[(2R,3S)-4,4,4-trifluoro-1-[2-fluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-3-hydroxy-2-methylbutan-2-yl] N'-methylcarbamimidothioate (PubChem CID 130434903) has the molecular formula C21H21F4N5O3S and a molecular weight of 499.49 g/mol. Its IUPAC name is [(2R,3S)-4,4,4-trifluoro-1-[2-fluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-3-hydroxy-2-methylbutan-2-yl] N'-methylcarbamimidothioate.
| Compound Name | [(2R,3S)-4,4,4-trifluoro-1-[2-fluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-3-hydroxy-2-methylbutan-2-yl] N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 130434903 |
| Molecular Formula | C21H21F4N5O3S |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | [(2R,3S)-4,4,4-trifluoro-1-[2-fluoro-5-[(5-prop-2-ynoxypyrazine-2-carbonyl)amino]phenyl]-3-hydroxy-2-methylbutan-2-yl] N'-methylcarbamimidothioate |
| SMILES | C#CCOc1cnc(C(=O)Nc2ccc(F)c(C[C@@](C)(S/C(N)=N/C)[C@@H](O)C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C21H21F4N5O3S/c1-4-7-33-16-11-28-15(10-29-16)17(31)30-13-5-6-14(22)12(8-13)9-20(2,34-19(26)27-3)18(32)21(23,24)25/h1,5-6,8,10-11,18,32H,7,9H2,2-3H3,(H2,26,27)(H,30,31)/t18-,20-/m1/s1 |
| InChIKey | UDDRYQSXWWBYHE-UYAOXDASSA-N |
| XLogP | 2.78 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|