C28H41F2N5O2S — CID 144786084
5-(4,4-dimethylpent-2-ynoxy)-N-(3-ethyl-4-fluorophenyl)pyrazine-2-carboxamide;3-fluoro-N'-methyl-2-sulfanylpropanimidamide;2-methylpropane (PubChem CID 144786084) has the molecular formula C28H41F2N5O2S and a molecular weight of 549.73 g/mol. Its IUPAC name is 5-(4,4-dimethylpent-2-ynoxy)-N-(3-ethyl-4-fluorophenyl)pyrazine-2-carboxamide;3-fluoro-N'-methyl-2-sulfanylpropanimidamide;2-methylpropane.
| Compound Name | 5-(4,4-dimethylpent-2-ynoxy)-N-(3-ethyl-4-fluorophenyl)pyrazine-2-carboxamide;3-fluoro-N'-methyl-2-sulfanylpropanimidamide;2-methylpropane |
|---|---|
| PubChem CID | 144786084 |
| Molecular Formula | C28H41F2N5O2S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 5-(4,4-dimethylpent-2-ynoxy)-N-(3-ethyl-4-fluorophenyl)pyrazine-2-carboxamide;3-fluoro-N'-methyl-2-sulfanylpropanimidamide;2-methylpropane |
| SMILES | C/N=C(\N)C(S)CF.CC(C)C.CCc1cc(NC(=O)c2cnc(OCC#CC(C)(C)C)cn2)ccc1F |
| InChI | InChI=1S/C20H22FN3O2.C4H9FN2S.C4H10/c1-5-14-11-15(7-8-16(14)21)24-19(25)17-12-23-18(13-22-17)26-10-6-9-20(2,3)4;1-7-4(6)3(8)2-5;1-4(2)3/h7-8,11-13H,5,10H2,1-4H3,(H,24,25);3,8H,2H2,1H3,(H2,6,7);4H,1-3H3 |
| InChIKey | QBUWHNGGFCJUDI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|