C18H19F4N5O3 — CID 126693373
[(2S,3R)-1,1-difluoro-3-[2-fluoro-5-[[5-(fluoromethoxy)pyrazine-2-carbonyl]amino]phenyl]butan-2-yl] N'-methylcarbamimidate (PubChem CID 126693373) has the molecular formula C18H19F4N5O3 and a molecular weight of 429.37 g/mol. Its IUPAC name is [(2S,3R)-1,1-difluoro-3-[2-fluoro-5-[[5-(fluoromethoxy)pyrazine-2-carbonyl]amino]phenyl]butan-2-yl] N'-methylcarbamimidate.
| Compound Name | [(2S,3R)-1,1-difluoro-3-[2-fluoro-5-[[5-(fluoromethoxy)pyrazine-2-carbonyl]amino]phenyl]butan-2-yl] N'-methylcarbamimidate |
|---|---|
| PubChem CID | 126693373 |
| Molecular Formula | C18H19F4N5O3 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [(2S,3R)-1,1-difluoro-3-[2-fluoro-5-[[5-(fluoromethoxy)pyrazine-2-carbonyl]amino]phenyl]butan-2-yl] N'-methylcarbamimidate |
| SMILES | C/N=C(\N)O[C@H](C(F)F)[C@H](C)c1cc(NC(=O)c2cnc(OCF)cn2)ccc1F |
| InChI | InChI=1S/C18H19F4N5O3/c1-9(15(16(21)22)30-18(23)24-2)11-5-10(3-4-12(11)20)27-17(28)13-6-26-14(7-25-13)29-8-19/h3-7,9,15-16H,8H2,1-2H3,(H2,23,24)(H,27,28)/t9-,15+/m1/s1 |
| InChIKey | BGBXBRHZSPSTEK-PSLIRLAXSA-N |
| XLogP | 2.87 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|