C18H19F3IN5O3 — CID 118441130
[(2S,3R,4S)-2,4-difluoro-1-[2-fluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]-1-iodopentan-3-yl] carbamimidate (PubChem CID 118441130) has the molecular formula C18H19F3IN5O3 and a molecular weight of 537.28 g/mol. Its IUPAC name is [(2S,3R,4S)-2,4-difluoro-1-[2-fluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]-1-iodopentan-3-yl] carbamimidate.
| Compound Name | [(2S,3R,4S)-2,4-difluoro-1-[2-fluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]-1-iodopentan-3-yl] carbamimidate |
|---|---|
| PubChem CID | 118441130 |
| Molecular Formula | C18H19F3IN5O3 |
| Molecular Weight | 537.28 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | [(2S,3R,4S)-2,4-difluoro-1-[2-fluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]-1-iodopentan-3-yl] carbamimidate |
| SMILES | [H]/N=C(\N)O[C@H]([C@H](C)F)[C@H](F)C(I)c1cc(NC(=O)c2cnc(OC)cn2)ccc1F |
| InChI | InChI=1S/C18H19F3IN5O3/c1-8(19)16(30-18(23)24)14(21)15(22)10-5-9(3-4-11(10)20)27-17(28)12-6-26-13(29-2)7-25-12/h3-8,14-16H,1-2H3,(H3,23,24)(H,27,28)/t8-,14+,15?,16+/m0/s1 |
| InChIKey | PLOXWJJHQWXIBQ-DJCGDISBSA-N |
| XLogP | 3.33 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|