C17H16ClF4N5O2 — CID 139564319
[(2R,4R)-4-[5-[(5-chloropyridine-2-carbonyl)amino]-2-fluoro-3-pyridinyl]-1,1,1-trifluoropentan-2-yl] carbamimidate (PubChem CID 139564319) has the molecular formula C17H16ClF4N5O2 and a molecular weight of 433.79 g/mol. Its IUPAC name is [(2R,4R)-4-[5-[(5-chloropyridine-2-carbonyl)amino]-2-fluoro-3-pyridinyl]-1,1,1-trifluoropentan-2-yl] carbamimidate.
| Compound Name | [(2R,4R)-4-[5-[(5-chloropyridine-2-carbonyl)amino]-2-fluoro-3-pyridinyl]-1,1,1-trifluoropentan-2-yl] carbamimidate |
|---|---|
| PubChem CID | 139564319 |
| Molecular Formula | C17H16ClF4N5O2 |
| Molecular Weight | 433.79 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [(2R,4R)-4-[5-[(5-chloropyridine-2-carbonyl)amino]-2-fluoro-3-pyridinyl]-1,1,1-trifluoropentan-2-yl] carbamimidate |
| SMILES | [H]/N=C(\N)O[C@H](C[C@@H](C)c1cc(NC(=O)c2ccc(Cl)cn2)cnc1F)C(F)(F)F |
| InChI | InChI=1S/C17H16ClF4N5O2/c1-8(4-13(17(20,21)22)29-16(23)24)11-5-10(7-26-14(11)19)27-15(28)12-3-2-9(18)6-25-12/h2-3,5-8,13H,4H2,1H3,(H3,23,24)(H,27,28)/t8-,13-/m1/s1 |
| InChIKey | SVGLAOLZRLEMMG-AMIZOPFISA-N |
| XLogP | 3.86 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|