C17H19ClF3N7O2 — CID 126754837
N-[3-[(2R,4R)-4-amino-2-(carbamoylamino)-1,1-difluoro-4-hydrazinylbutan-2-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 126754837) has the molecular formula C17H19ClF3N7O2 and a molecular weight of 445.83 g/mol. Its IUPAC name is N-[3-[(2R,4R)-4-amino-2-(carbamoylamino)-1,1-difluoro-4-hydrazinylbutan-2-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(2R,4R)-4-amino-2-(carbamoylamino)-1,1-difluoro-4-hydrazinylbutan-2-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 126754837 |
| Molecular Formula | C17H19ClF3N7O2 |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[3-[(2R,4R)-4-amino-2-(carbamoylamino)-1,1-difluoro-4-hydrazinylbutan-2-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | NN[C@@H](N)C[C@@](NC(N)=O)(c1cc(NC(=O)c2ccc(Cl)cn2)ccc1F)C(F)F |
| InChI | InChI=1S/C17H19ClF3N7O2/c18-8-1-4-12(25-7-8)14(29)26-9-2-3-11(19)10(5-9)17(15(20)21,27-16(23)30)6-13(22)28-24/h1-5,7,13,15,28H,6,22,24H2,(H,26,29)(H3,23,27,30)/t13-,17-/m1/s1 |
| InChIKey | GOOGPWYEASGBJM-CXAGYDPISA-N |
| XLogP | 1.39 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|