C18H17ClF2N4O2 — CID 126755298
[(1R)-2-[3-[(5-chloropyridine-2-carbonyl)amino]phenyl]cyclopropyl] N'-(2,2-difluoroethyl)carbamimidate (PubChem CID 126755298) has the molecular formula C18H17ClF2N4O2 and a molecular weight of 394.81 g/mol. Its IUPAC name is [(1R)-2-[3-[(5-chloropyridine-2-carbonyl)amino]phenyl]cyclopropyl] N'-(2,2-difluoroethyl)carbamimidate.
| Compound Name | [(1R)-2-[3-[(5-chloropyridine-2-carbonyl)amino]phenyl]cyclopropyl] N'-(2,2-difluoroethyl)carbamimidate |
|---|---|
| PubChem CID | 126755298 |
| Molecular Formula | C18H17ClF2N4O2 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [(1R)-2-[3-[(5-chloropyridine-2-carbonyl)amino]phenyl]cyclopropyl] N'-(2,2-difluoroethyl)carbamimidate |
| SMILES | N/C(=N\CC(F)F)O[C@@H]1CC1c1cccc(NC(=O)c2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C18H17ClF2N4O2/c19-11-4-5-14(23-8-11)17(26)25-12-3-1-2-10(6-12)13-7-15(13)27-18(22)24-9-16(20)21/h1-6,8,13,15-16H,7,9H2,(H2,22,24)(H,25,26)/t13?,15-/m1/s1 |
| InChIKey | IRYKYEFRLDALKV-AWKYBWMHSA-N |
| XLogP | 3.44 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|