C20H17ClF2N6O4 — CID 144698636
[(1R,2R)-2-[2-chloro-5-[[5-(1,3-oxazol-4-ylmethoxy)pyrazine-2-carbonyl]amino]phenyl]cyclopropyl] N'-(difluoromethyl)carbamimidate (PubChem CID 144698636) has the molecular formula C20H17ClF2N6O4 and a molecular weight of 478.84 g/mol. Its IUPAC name is [(1R,2R)-2-[2-chloro-5-[[5-(1,3-oxazol-4-ylmethoxy)pyrazine-2-carbonyl]amino]phenyl]cyclopropyl] N'-(difluoromethyl)carbamimidate.
| Compound Name | [(1R,2R)-2-[2-chloro-5-[[5-(1,3-oxazol-4-ylmethoxy)pyrazine-2-carbonyl]amino]phenyl]cyclopropyl] N'-(difluoromethyl)carbamimidate |
|---|---|
| PubChem CID | 144698636 |
| Molecular Formula | C20H17ClF2N6O4 |
| Molecular Weight | 478.84 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | [(1R,2R)-2-[2-chloro-5-[[5-(1,3-oxazol-4-ylmethoxy)pyrazine-2-carbonyl]amino]phenyl]cyclopropyl] N'-(difluoromethyl)carbamimidate |
| SMILES | N/C(=N/C(F)F)O[C@@H]1C[C@@H]1c1cc(NC(=O)c2cnc(OCc3cocn3)cn2)ccc1Cl |
| InChI | InChI=1S/C20H17ClF2N6O4/c21-14-2-1-10(3-12(14)13-4-16(13)33-20(24)29-19(22)23)28-18(30)15-5-26-17(6-25-15)32-8-11-7-31-9-27-11/h1-3,5-7,9,13,16,19H,4,8H2,(H2,24,29)(H,28,30)/t13-,16-/m1/s1 |
| InChIKey | GYSKLHAOWLYBGA-CZUORRHYSA-N |
| XLogP | 3.36 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|