C16H14ClF4N5O2 — CID 130409352
3,3-difluoropropyl N'-[2-chloro-5-[[5-(difluoromethyl)pyrazine-2-carbonyl]amino]phenyl]carbamimidate (PubChem CID 130409352) has the molecular formula C16H14ClF4N5O2 and a molecular weight of 419.77 g/mol. Its IUPAC name is 3,3-difluoropropyl N'-[2-chloro-5-[[5-(difluoromethyl)pyrazine-2-carbonyl]amino]phenyl]carbamimidate.
| Compound Name | 3,3-difluoropropyl N'-[2-chloro-5-[[5-(difluoromethyl)pyrazine-2-carbonyl]amino]phenyl]carbamimidate |
|---|---|
| PubChem CID | 130409352 |
| Molecular Formula | C16H14ClF4N5O2 |
| Molecular Weight | 419.77 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3,3-difluoropropyl N'-[2-chloro-5-[[5-(difluoromethyl)pyrazine-2-carbonyl]amino]phenyl]carbamimidate |
| SMILES | N/C(=N/c1cc(NC(=O)c2cnc(C(F)F)cn2)ccc1Cl)OCCC(F)F |
| InChI | InChI=1S/C16H14ClF4N5O2/c17-9-2-1-8(5-10(9)26-16(22)28-4-3-13(18)19)25-15(27)12-7-23-11(6-24-12)14(20)21/h1-2,5-7,13-14H,3-4H2,(H2,22,26)(H,25,27) |
| InChIKey | TUOXRBGIVQYTKG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|