C19H22N5O4P — CID 144615578
N-[3-[(4aS,7aS)-2-amino-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-7a-yl]-4-phosphanylphenyl]-5-ethoxypyrazine-2-carboxamide (PubChem CID 144615578) has the molecular formula C19H22N5O4P and a molecular weight of 415.39 g/mol. Its IUPAC name is N-[3-[(4aS,7aS)-2-amino-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-7a-yl]-4-phosphanylphenyl]-5-ethoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4aS,7aS)-2-amino-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-7a-yl]-4-phosphanylphenyl]-5-ethoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 144615578 |
| Molecular Formula | C19H22N5O4P |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[3-[(4aS,7aS)-2-amino-4,4a,6,7-tetrahydrofuro[3,2-d][1,3]oxazin-7a-yl]-4-phosphanylphenyl]-5-ethoxypyrazine-2-carboxamide |
| SMILES | CCOc1cnc(C(=O)Nc2ccc(P)c([C@@]34CCO[C@@H]3COC(N)=N4)c2)cn1 |
| InChI | InChI=1S/C19H22N5O4P/c1-2-26-16-9-21-13(8-22-16)17(25)23-11-3-4-14(29)12(7-11)19-5-6-27-15(19)10-28-18(20)24-19/h3-4,7-9,15H,2,5-6,10,29H2,1H3,(H2,20,24)(H,23,25)/t15-,19+/m1/s1 |
| InChIKey | JIKPFOJJPILVDK-BEFAXECRSA-N |
| XLogP | 0.96 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|