C19H17F4N5O2 — CID 126693471
[(3R)-3-[5-[(5-cyanopyridine-2-carbonyl)amino]-2-fluorophenyl]-1,1,1-trifluorobutan-2-yl] N'-methylcarbamimidate (PubChem CID 126693471) has the molecular formula C19H17F4N5O2 and a molecular weight of 423.37 g/mol. Its IUPAC name is [(3R)-3-[5-[(5-cyanopyridine-2-carbonyl)amino]-2-fluorophenyl]-1,1,1-trifluorobutan-2-yl] N'-methylcarbamimidate.
| Compound Name | [(3R)-3-[5-[(5-cyanopyridine-2-carbonyl)amino]-2-fluorophenyl]-1,1,1-trifluorobutan-2-yl] N'-methylcarbamimidate |
|---|---|
| PubChem CID | 126693471 |
| Molecular Formula | C19H17F4N5O2 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [(3R)-3-[5-[(5-cyanopyridine-2-carbonyl)amino]-2-fluorophenyl]-1,1,1-trifluorobutan-2-yl] N'-methylcarbamimidate |
| SMILES | C/N=C(\N)OC([C@H](C)c1cc(NC(=O)c2ccc(C#N)cn2)ccc1F)C(F)(F)F |
| InChI | InChI=1S/C19H17F4N5O2/c1-10(16(19(21,22)23)30-18(25)26-2)13-7-12(4-5-14(13)20)28-17(29)15-6-3-11(8-24)9-27-15/h3-7,9-10,16H,1-2H3,(H2,25,26)(H,28,29)/t10-,16?/m1/s1 |
| InChIKey | OLICALKIGLKVPB-HQNRFAHOSA-N |
| XLogP | 3.34 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|