C14H14ClF3N4O2 — CID 123918989
4-chloro-1-(difluoromethyl)-N-[6-fluoro-5-(4-hydroxybutan-2-yl)-3-pyridinyl]pyrazole-3-carboxamide (PubChem CID 123918989) has the molecular formula C14H14ClF3N4O2 and a molecular weight of 362.74 g/mol. Its IUPAC name is 4-chloro-1-(difluoromethyl)-N-[6-fluoro-5-(4-hydroxybutan-2-yl)-3-pyridinyl]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1-(difluoromethyl)-N-[6-fluoro-5-(4-hydroxybutan-2-yl)-3-pyridinyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 123918989 |
| Molecular Formula | C14H14ClF3N4O2 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-chloro-1-(difluoromethyl)-N-[6-fluoro-5-(4-hydroxybutan-2-yl)-3-pyridinyl]pyrazole-3-carboxamide |
| SMILES | CC(CCO)c1cc(NC(=O)c2nn(C(F)F)cc2Cl)cnc1F |
| InChI | InChI=1S/C14H14ClF3N4O2/c1-7(2-3-23)9-4-8(5-19-12(9)16)20-13(24)11-10(15)6-22(21-11)14(17)18/h4-7,14,23H,2-3H2,1H3,(H,20,24) |
| InChIKey | RFZWDONBSGCCFS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|