C17H19F2N5O2S — CID 126488043
[(2R)-1-[2,3-difluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]propan-2-yl] N'-methylcarbamimidothioate (PubChem CID 126488043) has the molecular formula C17H19F2N5O2S and a molecular weight of 395.44 g/mol. Its IUPAC name is [(2R)-1-[2,3-difluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]propan-2-yl] N'-methylcarbamimidothioate.
| Compound Name | [(2R)-1-[2,3-difluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]propan-2-yl] N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 126488043 |
| Molecular Formula | C17H19F2N5O2S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [(2R)-1-[2,3-difluoro-5-[(5-methoxypyrazine-2-carbonyl)amino]phenyl]propan-2-yl] N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)S[C@H](C)Cc1cc(NC(=O)c2cnc(OC)cn2)cc(F)c1F |
| InChI | InChI=1S/C17H19F2N5O2S/c1-9(27-17(20)21-2)4-10-5-11(6-12(18)15(10)19)24-16(25)13-7-23-14(26-3)8-22-13/h5-9H,4H2,1-3H3,(H2,20,21)(H,24,25)/t9-/m1/s1 |
| InChIKey | HHKZZGXFWMRHKY-SECBINFHSA-N |
| XLogP | 2.62 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|