C16H14BrClF2N4O2 — CID 139564193
2-[5-[(5-bromo-3-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]ethyl N'-methylcarbamimidate (PubChem CID 139564193) has the molecular formula C16H14BrClF2N4O2 and a molecular weight of 447.67 g/mol. Its IUPAC name is 2-[5-[(5-bromo-3-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]ethyl N'-methylcarbamimidate.
| Compound Name | 2-[5-[(5-bromo-3-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]ethyl N'-methylcarbamimidate |
|---|---|
| PubChem CID | 139564193 |
| Molecular Formula | C16H14BrClF2N4O2 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 2-[5-[(5-bromo-3-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]ethyl N'-methylcarbamimidate |
| SMILES | C/N=C(\N)OCCc1cc(NC(=O)c2ncc(Br)cc2Cl)cc(F)c1F |
| InChI | InChI=1S/C16H14BrClF2N4O2/c1-22-16(21)26-3-2-8-4-10(6-12(19)13(8)20)24-15(25)14-11(18)5-9(17)7-23-14/h4-7H,2-3H2,1H3,(H2,21,22)(H,24,25) |
| InChIKey | BWLAVYUVLCSXHK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|