C19H19ClF2N4O3S — CID 126487779
methyl (2R)-3-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-2-methyl-2-(N'-methylcarbamimidoyl)sulfanylpropanoate (PubChem CID 126487779) has the molecular formula C19H19ClF2N4O3S and a molecular weight of 456.90 g/mol. Its IUPAC name is methyl (2R)-3-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-2-methyl-2-(N'-methylcarbamimidoyl)sulfanylpropanoate.
| Compound Name | methyl (2R)-3-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-2-methyl-2-(N'-methylcarbamimidoyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 126487779 |
| Molecular Formula | C19H19ClF2N4O3S |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | methyl (2R)-3-[5-[(5-chloropyridine-2-carbonyl)amino]-2,3-difluorophenyl]-2-methyl-2-(N'-methylcarbamimidoyl)sulfanylpropanoate |
| SMILES | C/N=C(\N)S[C@](C)(Cc1cc(NC(=O)c2ccc(Cl)cn2)cc(F)c1F)C(=O)OC |
| InChI | InChI=1S/C19H19ClF2N4O3S/c1-19(17(28)29-3,30-18(23)24-2)8-10-6-12(7-13(21)15(10)22)26-16(27)14-5-4-11(20)9-25-14/h4-7,9H,8H2,1-3H3,(H2,23,24)(H,26,27)/t19-/m1/s1 |
| InChIKey | SAMGJKQHNIZPCH-LJQANCHMSA-N |
| XLogP | 3.42 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|