C17H19FN4O3 — CID 58056040
methyl N'-[1-[2-fluoro-5-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]phenyl]ethyl]carbamimidate (PubChem CID 58056040) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl N'-[1-[2-fluoro-5-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]phenyl]ethyl]carbamimidate.
| Compound Name | methyl N'-[1-[2-fluoro-5-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]phenyl]ethyl]carbamimidate |
|---|---|
| PubChem CID | 58056040 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl N'-[1-[2-fluoro-5-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]phenyl]ethyl]carbamimidate |
| SMILES | CO/C(N)=N\C(C)c1cc(CC(=O)c2cnc(OC)cn2)ccc1F |
| InChI | InChI=1S/C17H19FN4O3/c1-10(22-17(19)25-3)12-6-11(4-5-13(12)18)7-15(23)14-8-21-16(24-2)9-20-14/h4-6,8-10H,7H2,1-3H3,(H2,19,22) |
| InChIKey | RUNBYHKZUNVHGJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|