C20H20N4O3 — CID 58056053
methyl N'-[7-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]-2-methylnaphthalen-1-yl]carbamimidate (PubChem CID 58056053) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl N'-[7-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]-2-methylnaphthalen-1-yl]carbamimidate.
| Compound Name | methyl N'-[7-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]-2-methylnaphthalen-1-yl]carbamimidate |
|---|---|
| PubChem CID | 58056053 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl N'-[7-[2-(5-methoxypyrazin-2-yl)-2-oxoethyl]-2-methylnaphthalen-1-yl]carbamimidate |
| SMILES | CO/C(N)=N\c1c(C)ccc2ccc(CC(=O)c3cnc(OC)cn3)cc12 |
| InChI | InChI=1S/C20H20N4O3/c1-12-4-6-14-7-5-13(8-15(14)19(12)24-20(21)27-3)9-17(25)16-10-23-18(26-2)11-22-16/h4-8,10-11H,9H2,1-3H3,(H2,21,24) |
| InChIKey | LJXZKXMVKBSRCC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|