C23H19ClN4O2 — CID 58055885
methyl N'-[(4-chlorophenyl)-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]methyl]carbamimidate (PubChem CID 58055885) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is methyl N'-[(4-chlorophenyl)-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]methyl]carbamimidate.
| Compound Name | methyl N'-[(4-chlorophenyl)-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]methyl]carbamimidate |
|---|---|
| PubChem CID | 58055885 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methyl N'-[(4-chlorophenyl)-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]methyl]carbamimidate |
| SMILES | CO/C(N)=N\C(c1ccc(Cl)cc1)c1cccc(CC(=O)c2ccc(C#N)cn2)c1 |
| InChI | InChI=1S/C23H19ClN4O2/c1-30-23(26)28-22(17-6-8-19(24)9-7-17)18-4-2-3-15(11-18)12-21(29)20-10-5-16(13-25)14-27-20/h2-11,14,22H,12H2,1H3,(H2,26,28) |
| InChIKey | LCVBRZXIFJJFGG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|