C18H18N4O2 — CID 58055966
methyl N'-[1-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]ethyl]carbamimidate (PubChem CID 58055966) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is methyl N'-[1-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]ethyl]carbamimidate.
| Compound Name | methyl N'-[1-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]ethyl]carbamimidate |
|---|---|
| PubChem CID | 58055966 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl N'-[1-[3-[2-(5-cyano-2-pyridinyl)-2-oxoethyl]phenyl]ethyl]carbamimidate |
| SMILES | CO/C(N)=N\C(C)c1cccc(CC(=O)c2ccc(C#N)cn2)c1 |
| InChI | InChI=1S/C18H18N4O2/c1-12(22-18(20)24-2)15-5-3-4-13(8-15)9-17(23)16-7-6-14(10-19)11-21-16/h3-8,11-12H,9H2,1-2H3,(H2,20,22) |
| InChIKey | HIASTELRZPVGDZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|