C16H15N3O2S — CID 97001137
5-cyano-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]pyridine-2-carboxamide (PubChem CID 97001137) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 5-cyano-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97001137 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-cyano-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]pyridine-2-carboxamide |
| SMILES | C[S@](=O)C[C@@H](NC(=O)c1ccc(C#N)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3O2S/c1-22(21)11-15(13-5-3-2-4-6-13)19-16(20)14-8-7-12(9-17)10-18-14/h2-8,10,15H,11H2,1H3,(H,19,20)/t15-,22+/m1/s1 |
| InChIKey | FNFVAIGMRZZVHH-QRQCRPRQSA-N |
| XLogP | 1.80 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |