C14H12ClFN2O — CID 104643141
N-(2-chloro-1-phenylethyl)-5-fluoropyridine-2-carboxamide (PubChem CID 104643141) has the molecular formula C14H12ClFN2O and a molecular weight of 278.71 g/mol. Its IUPAC name is N-(2-chloro-1-phenylethyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-(2-chloro-1-phenylethyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 104643141 |
| Molecular Formula | C14H12ClFN2O |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-(2-chloro-1-phenylethyl)-5-fluoropyridine-2-carboxamide |
| SMILES | O=C(NC(CCl)c1ccccc1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H12ClFN2O/c15-8-13(10-4-2-1-3-5-10)18-14(19)12-7-6-11(16)9-17-12/h1-7,9,13H,8H2,(H,18,19) |
| InChIKey | KQYGBTFHOGVHHU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|