C11H14BrFN2O — CID 104643211
N-(4-bromopentan-2-yl)-5-fluoropyridine-2-carboxamide (PubChem CID 104643211) has the molecular formula C11H14BrFN2O and a molecular weight of 289.15 g/mol. Its IUPAC name is N-(4-bromopentan-2-yl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-(4-bromopentan-2-yl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 104643211 |
| Molecular Formula | C11H14BrFN2O |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(4-bromopentan-2-yl)-5-fluoropyridine-2-carboxamide |
| SMILES | CC(Br)CC(C)NC(=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H14BrFN2O/c1-7(12)5-8(2)15-11(16)10-4-3-9(13)6-14-10/h3-4,6-8H,5H2,1-2H3,(H,15,16) |
| InChIKey | RVNTUOCKBKWUFM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|