C19H18F3N5O3 — CID 88931010
N-[3-[[[1-amino-2-(2,2-difluoroethoxy)ethylidene]amino]methyl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide (PubChem CID 88931010) has the molecular formula C19H18F3N5O3 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[3-[[[1-amino-2-(2,2-difluoroethoxy)ethylidene]amino]methyl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[[[1-amino-2-(2,2-difluoroethoxy)ethylidene]amino]methyl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88931010 |
| Molecular Formula | C19H18F3N5O3 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[3-[[[1-amino-2-(2,2-difluoroethoxy)ethylidene]amino]methyl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide |
| SMILES | C#CCOc1cnc(C(=O)Nc2ccc(F)c(C/N=C(/N)COCC(F)F)c2)cn1 |
| InChI | InChI=1S/C19H18F3N5O3/c1-2-5-30-18-9-24-15(8-26-18)19(28)27-13-3-4-14(20)12(6-13)7-25-17(23)11-29-10-16(21)22/h1,3-4,6,8-9,16H,5,7,10-11H2,(H2,23,25)(H,27,28) |
| InChIKey | PVBZZDDNWVXOFK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|