C15H16ClFN4O — CID 109273040
N-(3-chloro-4-fluorophenyl)-5-(2-methylpropylamino)pyrazine-2-carboxamide (PubChem CID 109273040) has the molecular formula C15H16ClFN4O and a molecular weight of 322.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-(2-methylpropylamino)pyrazine-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-(2-methylpropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109273040 |
| Molecular Formula | C15H16ClFN4O |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-(2-methylpropylamino)pyrazine-2-carboxamide |
| SMILES | CC(C)CNc1cnc(C(=O)Nc2ccc(F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C15H16ClFN4O/c1-9(2)6-19-14-8-18-13(7-20-14)15(22)21-10-3-4-12(17)11(16)5-10/h3-5,7-9H,6H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QEOJLFLNLKYZOY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |