C19H27N5O — CID 109273070
N-[4-(diethylamino)phenyl]-5-(2-methylpropylamino)pyrazine-2-carboxamide (PubChem CID 109273070) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-(2-methylpropylamino)pyrazine-2-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-5-(2-methylpropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109273070 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-(2-methylpropylamino)pyrazine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cnc(NCC(C)C)cn2)cc1 |
| InChI | InChI=1S/C19H27N5O/c1-5-24(6-2)16-9-7-15(8-10-16)23-19(25)17-12-22-18(13-20-17)21-11-14(3)4/h7-10,12-14H,5-6,11H2,1-4H3,(H,21,22)(H,23,25) |
| InChIKey | KIAYRWRUTCDFRA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|