C26H31FN4O3S — CID 144651950
N-[cyclopropylidene-(5-prop-2-ynoxypyrazin-2-yl)methyl]-4-fluoro-3-[(2R)-1-(3-imino-2-methylpentan-2-yl)sulfonylpropan-2-yl]aniline (PubChem CID 144651950) has the molecular formula C26H31FN4O3S and a molecular weight of 498.62 g/mol. Its IUPAC name is N-[cyclopropylidene-(5-prop-2-ynoxypyrazin-2-yl)methyl]-4-fluoro-3-[(2R)-1-(3-imino-2-methylpentan-2-yl)sulfonylpropan-2-yl]aniline.
| Compound Name | N-[cyclopropylidene-(5-prop-2-ynoxypyrazin-2-yl)methyl]-4-fluoro-3-[(2R)-1-(3-imino-2-methylpentan-2-yl)sulfonylpropan-2-yl]aniline |
|---|---|
| PubChem CID | 144651950 |
| Molecular Formula | C26H31FN4O3S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[cyclopropylidene-(5-prop-2-ynoxypyrazin-2-yl)methyl]-4-fluoro-3-[(2R)-1-(3-imino-2-methylpentan-2-yl)sulfonylpropan-2-yl]aniline |
| SMILES | [H]/N=C(\CC)C(C)(C)S(=O)(=O)C[C@H](C)c1cc(NC(=C2CC2)c2cnc(OCC#C)cn2)ccc1F |
| InChI | InChI=1S/C26H31FN4O3S/c1-6-12-34-24-15-29-22(14-30-24)25(18-8-9-18)31-19-10-11-21(27)20(13-19)17(3)16-35(32,33)26(4,5)23(28)7-2/h1,10-11,13-15,17,28,31H,7-9,12,16H2,2-5H3/b28-23+/t17-/m0/s1 |
| InChIKey | JYEMJHCHTHGXLX-ZKAUOXRGSA-N |
| XLogP | 4.97 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|