C19H20F4N4O3 — CID 139564364
[(3R)-3-[5-[[5-(difluoromethoxy)-3-methylpyridine-2-carbonyl]amino]-2,3-difluorophenyl]butyl] carbamimidate (PubChem CID 139564364) has the molecular formula C19H20F4N4O3 and a molecular weight of 428.39 g/mol. Its IUPAC name is [(3R)-3-[5-[[5-(difluoromethoxy)-3-methylpyridine-2-carbonyl]amino]-2,3-difluorophenyl]butyl] carbamimidate.
| Compound Name | [(3R)-3-[5-[[5-(difluoromethoxy)-3-methylpyridine-2-carbonyl]amino]-2,3-difluorophenyl]butyl] carbamimidate |
|---|---|
| PubChem CID | 139564364 |
| Molecular Formula | C19H20F4N4O3 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [(3R)-3-[5-[[5-(difluoromethoxy)-3-methylpyridine-2-carbonyl]amino]-2,3-difluorophenyl]butyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC[C@@H](C)c1cc(NC(=O)c2ncc(OC(F)F)cc2C)cc(F)c1F |
| InChI | InChI=1S/C19H20F4N4O3/c1-9(3-4-29-19(24)25)13-6-11(7-14(20)15(13)21)27-17(28)16-10(2)5-12(8-26-16)30-18(22)23/h5-9,18H,3-4H2,1-2H3,(H3,24,25)(H,27,28)/t9-/m1/s1 |
| InChIKey | ZOIJTWXICSVJES-SECBINFHSA-N |
| XLogP | 3.93 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|