C21H24F2N4O5S — CID 134426736
N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-1H-isochromen-6-yl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 134426736) has the molecular formula C21H24F2N4O5S and a molecular weight of 482.51 g/mol. Its IUPAC name is N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-1H-isochromen-6-yl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-1H-isochromen-6-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134426736 |
| Molecular Formula | C21H24F2N4O5S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-1H-isochromen-6-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | [H]/N=C(\N)C(C)(C)S(=O)(=O)CC1COCc2ccc(NC(=O)c3ccc(OC(F)F)cn3)cc21 |
| InChI | InChI=1S/C21H24F2N4O5S/c1-21(2,19(24)25)33(29,30)11-13-10-31-9-12-3-4-14(7-16(12)13)27-18(28)17-6-5-15(8-26-17)32-20(22)23/h3-8,13,20H,9-11H2,1-2H3,(H3,24,25)(H,27,28) |
| InChIKey | VXQKQVNDONWJQB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|