C34H26N10O9S2 — CID 6791221
5-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]hydrazinylidene]-6-[(3-nitrophenyl)diazenyl]-4-oxonaphthalene-2,7-disulfonic acid (PubChem CID 6791221) has the molecular formula C34H26N10O9S2 and a molecular weight of 782.78 g/mol. Its IUPAC name is 5-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]hydrazinylidene]-6-[(3-nitrophenyl)diazenyl]-4-oxonaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]hydrazinylidene]-6-[(3-nitrophenyl)diazenyl]-4-oxonaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 6791221 |
| Molecular Formula | C34H26N10O9S2 |
| Molecular Weight | 782.78 g/mol |
| Exact Mass | 782.13 |
| IUPAC Name | 5-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]hydrazinylidene]-6-[(3-nitrophenyl)diazenyl]-4-oxonaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(-c3ccc(NN=C4C(=O)c5c(cc(S(=O)(=O)O)c(/N=N/c6cccc([N+](=O)[O-])c6)c5N)C=C4S(=O)(=O)O)cc3)cc2)c(N)c1 |
| InChI | InChI=1S/C34H26N10O9S2/c35-21-8-13-27(26(36)16-21)41-38-22-9-4-18(5-10-22)19-6-11-23(12-7-19)39-43-33-29(55(51,52)53)15-20-14-28(54(48,49)50)32(31(37)30(20)34(33)45)42-40-24-2-1-3-25(17-24)44(46)47/h1-17,39H,35-37H2,(H,48,49,50)(H,51,52,53)/b41-38+,42-40+,43-33? |
| InChIKey | FBUNDAGZCXOKSE-DJYXYBEASA-N |
| XLogP | 6.98 |
| TPSA | 320.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.78 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|