C34H28N10O10S3 — CID 54421966
4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid (PubChem CID 54421966) has the molecular formula C34H28N10O10S3 and a molecular weight of 832.86 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 54421966 |
| Molecular Formula | C34H28N10O10S3 |
| Molecular Weight | 832.86 g/mol |
| Exact Mass | 832.12 |
| IUPAC Name | 4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(Nc3ccc(/N=N/c4c(S(=O)(=O)O)cc5c(c4N)C(=O)C(=NNc4ccccc4)C(S(=O)(=O)O)=C5)cc3S(=O)(=O)O)cc2)c(N)c1 |
| InChI | InChI=1S/C34H28N10O10S3/c35-19-6-12-25(24(36)16-19)42-39-22-9-7-20(8-10-22)38-26-13-11-23(17-27(26)55(46,47)48)41-43-32-28(56(49,50)51)14-18-15-29(57(52,53)54)33(34(45)30(18)31(32)37)44-40-21-4-2-1-3-5-21/h1-17,38,40H,35-37H2,(H,46,47,48)(H,49,50,51)(H,52,53,54)/b42-39+,43-41+,44-33? |
| InChIKey | KWVXGUWQXJDWLE-WPQOLHCASA-N |
| XLogP | 6.39 |
| TPSA | 344.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.86 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|