C28H24N10O7S2 — CID 122542894
(3E)-6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]-3-sulfophenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid (PubChem CID 122542894) has the molecular formula C28H24N10O7S2 and a molecular weight of 676.70 g/mol. Its IUPAC name is (3E)-6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]-3-sulfophenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid.
| Compound Name | (3E)-6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]-3-sulfophenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 122542894 |
| Molecular Formula | C28H24N10O7S2 |
| Molecular Weight | 676.70 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | (3E)-6-[(2,4-diaminophenyl)diazenyl]-3-[[4-[(2,4-diaminophenyl)diazenyl]-3-sulfophenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc3c(c2)C(=O)/C(=N\Nc2ccc(/N=N/c4ccc(N)cc4N)c(S(=O)(=O)O)c2)C(S(=O)(=O)O)=C3)c(N)c1 |
| InChI | InChI=1S/C28H24N10O7S2/c29-15-2-6-22(20(31)10-15)35-33-17-4-1-14-9-26(47(43,44)45)27(28(39)19(14)12-17)38-34-18-5-8-24(25(13-18)46(40,41)42)37-36-23-7-3-16(30)11-21(23)32/h1-13,34H,29-32H2,(H,40,41,42)(H,43,44,45)/b35-33+,37-36+,38-27- |
| InChIKey | AUFNECWYRRYNKY-VEQPMGRISA-N |
| XLogP | 4.99 |
| TPSA | 303.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|