C32H23N9Na2O7S2 — CID 53428413
disodium;3-[[4-[(4-amino-7-sulfonatonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonate (PubChem CID 53428413) has the molecular formula C32H23N9Na2O7S2 and a molecular weight of 755.71 g/mol. Its IUPAC name is disodium;3-[[4-[(4-amino-7-sulfonatonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonate.
| Compound Name | disodium;3-[[4-[(4-amino-7-sulfonatonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 53428413 |
| Molecular Formula | C32H23N9Na2O7S2 |
| Molecular Weight | 755.71 g/mol |
| Exact Mass | 755.10 |
| IUPAC Name | disodium;3-[[4-[(4-amino-7-sulfonatonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonate |
| SMILES | Nc1ccc(/N=N/c2ccc3c(c2)C(=O)C(=NNc2ccc(/N=N/c4ccc(N)c5ccc(S(=O)(=O)[O-])cc45)cc2)C(S(=O)(=O)[O-])=C3)c(N)c1.[Na+].[Na+] |
| InChI | InChI=1S/C32H25N9O7S2.2Na/c33-18-2-11-29(27(35)14-18)40-38-21-3-1-17-13-30(50(46,47)48)31(32(42)24(17)15-21)41-37-20-6-4-19(5-7-20)36-39-28-12-10-26(34)23-9-8-22(16-25(23)28)49(43,44)45;;/h1-16,37H,33-35H2,(H,43,44,45)(H,46,47,48);;/q;2*+1/p-2/b39-36+,40-38+,41-31?;; |
| InChIKey | ORUGDTBRDNUYBB-BLIIGQTGSA-L |
| XLogP | -0.12 |
| TPSA | 283.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.71 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|