C37H26N6O9S — CID 137145956
5-[[4-[[4-[2-(6-benzamido-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]carbamoyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 137145956) has the molecular formula C37H26N6O9S and a molecular weight of 730.72 g/mol. Its IUPAC name is 5-[[4-[[4-[2-(6-benzamido-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]carbamoyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[[4-[2-(6-benzamido-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]carbamoyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 137145956 |
| Molecular Formula | C37H26N6O9S |
| Molecular Weight | 730.72 g/mol |
| Exact Mass | 730.15 |
| IUPAC Name | 5-[[4-[[4-[2-(6-benzamido-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]carbamoyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(NN=C2C(=O)c3ccc(NC(=O)c4ccccc4)cc3C=C2S(=O)(=O)O)cc1)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C37H26N6O9S/c44-31-17-15-28(20-30(31)37(48)49)42-40-25-8-6-22(7-9-25)36(47)38-24-10-12-26(13-11-24)41-43-33-32(53(50,51)52)19-23-18-27(14-16-29(23)34(33)45)39-35(46)21-4-2-1-3-5-21/h1-20,41,44H,(H,38,47)(H,39,46)(H,48,49)(H,50,51,52)/b42-40+,43-33? |
| InChIKey | BKNPECZZZXHKNF-MBEREGRWSA-N |
| XLogP | 6.90 |
| TPSA | 236.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|