C39H27N5O12S4 — CID 6834028
3-oxo-4-[[4-[4-[[4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]benzoyl]amino]phenyl]sulfanylphenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid (PubChem CID 6834028) has the molecular formula C39H27N5O12S4 and a molecular weight of 885.94 g/mol. Its IUPAC name is 3-oxo-4-[[4-[4-[[4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]benzoyl]amino]phenyl]sulfanylphenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid.
| Compound Name | 3-oxo-4-[[4-[4-[[4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]benzoyl]amino]phenyl]sulfanylphenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 6834028 |
| Molecular Formula | C39H27N5O12S4 |
| Molecular Weight | 885.94 g/mol |
| Exact Mass | 885.05 |
| IUPAC Name | 3-oxo-4-[[4-[4-[[4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]benzoyl]amino]phenyl]sulfanylphenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid |
| SMILES | O=C1C(S(=O)(=O)O)=Cc2cc(S(=O)(=O)O)ccc2C1=NNc1ccc(Sc2ccc(NC(=O)c3ccc(NN=C4C=C(S(=O)(=O)O)c5ccccc5C4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H27N5O12S4/c45-37-32-4-2-1-3-31(32)34(59(51,52)53)21-33(37)43-41-25-7-5-22(6-8-25)39(47)40-24-9-13-27(14-10-24)57-28-15-11-26(12-16-28)42-44-36-30-18-17-29(58(48,49)50)19-23(30)20-35(38(36)46)60(54,55)56/h1-21,41-42H,(H,40,47)(H,48,49,50)(H,51,52,53)(H,54,55,56) |
| InChIKey | PJGRJSALVOXHQM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 275.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.94 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|