C40H31N5O10S2 — CID 78407613
7-anilino-3-[[2-methoxy-4-[3-methoxy-4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid (PubChem CID 78407613) has the molecular formula C40H31N5O10S2 and a molecular weight of 805.85 g/mol. Its IUPAC name is 7-anilino-3-[[2-methoxy-4-[3-methoxy-4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[2-methoxy-4-[3-methoxy-4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 78407613 |
| Molecular Formula | C40H31N5O10S2 |
| Molecular Weight | 805.85 g/mol |
| Exact Mass | 805.15 |
| IUPAC Name | 7-anilino-3-[[2-methoxy-4-[3-methoxy-4-[2-(1-oxo-4-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid |
| SMILES | COc1cc(-c2ccc(NN=C3C(=O)c4ccc(Nc5ccccc5)cc4C=C3S(=O)(=O)O)c(OC)c2)ccc1NN=C1C=C(S(=O)(=O)O)c2ccccc2C1=O |
| InChI | InChI=1S/C40H31N5O10S2/c1-54-34-19-23(12-16-31(34)42-44-33-22-36(56(48,49)50)29-10-6-7-11-30(29)39(33)46)24-13-17-32(35(20-24)55-2)43-45-38-37(57(51,52)53)21-25-18-27(14-15-28(25)40(38)47)41-26-8-4-3-5-9-26/h3-22,41-43H,1-2H3,(H,48,49,50)(H,51,52,53) |
| InChIKey | FQPDXHGLHUVXGO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 222.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.85 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|