C40H31N5O13S3 — CID 57356879
3-[[4-[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methoxyphenyl]-2-methoxyphenyl]hydrazinylidene]-4-oxonaphthalene-1,5-disulfonic acid (PubChem CID 57356879) has the molecular formula C40H31N5O13S3 and a molecular weight of 885.91 g/mol. Its IUPAC name is 3-[[4-[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methoxyphenyl]-2-methoxyphenyl]hydrazinylidene]-4-oxonaphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methoxyphenyl]-2-methoxyphenyl]hydrazinylidene]-4-oxonaphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 57356879 |
| Molecular Formula | C40H31N5O13S3 |
| Molecular Weight | 885.91 g/mol |
| Exact Mass | 885.11 |
| IUPAC Name | 3-[[4-[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methoxyphenyl]-2-methoxyphenyl]hydrazinylidene]-4-oxonaphthalene-1,5-disulfonic acid |
| SMILES | COc1cc(-c2ccc(NN=C3C(=O)c4ccc(Nc5ccccc5)cc4C=C3S(=O)(=O)O)c(OC)c2)ccc1NN=C1C=C(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c2C1=O |
| InChI | InChI=1S/C40H31N5O13S3/c1-57-32-18-22(11-15-29(32)42-44-31-21-35(60(51,52)53)28-9-6-10-34(59(48,49)50)37(28)40(31)47)23-12-16-30(33(19-23)58-2)43-45-38-36(61(54,55)56)20-24-17-26(13-14-27(24)39(38)46)41-25-7-4-3-5-8-25/h3-21,41-43H,1-2H3,(H,48,49,50)(H,51,52,53)(H,54,55,56) |
| InChIKey | UOZQOYBJJXINJV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 276.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.91 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|