C36H25N5O11S3 — CID 6787698
4-[[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 6787698) has the molecular formula C36H25N5O11S3 and a molecular weight of 799.82 g/mol. Its IUPAC name is 4-[[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 6787698 |
| Molecular Formula | C36H25N5O11S3 |
| Molecular Weight | 799.82 g/mol |
| Exact Mass | 799.07 |
| IUPAC Name | 4-[[4-[2-(6-anilino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=C1C(=NNc2ccc(/N=N/c3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(O)c34)c3ccccc23)C(S(=O)(=O)O)=Cc2cc(Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C36H25N5O11S3/c42-32-19-25(54(47,48)49)16-21-15-24(53(44,45)46)18-31(34(21)32)40-38-29-12-13-30(28-9-5-4-8-27(28)29)39-41-35-33(55(50,51)52)17-20-14-23(10-11-26(20)36(35)43)37-22-6-2-1-3-7-22/h1-19,37,39,42H,(H,44,45,46)(H,47,48,49)(H,50,51,52)/b40-38+,41-35? |
| InChIKey | QKZFTMLYRNJWPN-HZXPOUFSSA-N |
| XLogP | 7.24 |
| TPSA | 261.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.82 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|