C33H24N6O14S3 — CID 6912963
3-[(2-hydroxyphenyl)hydrazinylidene]-7-[[6-[(2-hydroxy-5-sulfophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]carbamoylamino]-4-oxonaphthalene-2-sulfonic acid (PubChem CID 6912963) has the molecular formula C33H24N6O14S3 and a molecular weight of 824.78 g/mol. Its IUPAC name is 3-[(2-hydroxyphenyl)hydrazinylidene]-7-[[6-[(2-hydroxy-5-sulfophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]carbamoylamino]-4-oxonaphthalene-2-sulfonic acid.
| Compound Name | 3-[(2-hydroxyphenyl)hydrazinylidene]-7-[[6-[(2-hydroxy-5-sulfophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]carbamoylamino]-4-oxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 6912963 |
| Molecular Formula | C33H24N6O14S3 |
| Molecular Weight | 824.78 g/mol |
| Exact Mass | 824.05 |
| IUPAC Name | 3-[(2-hydroxyphenyl)hydrazinylidene]-7-[[6-[(2-hydroxy-5-sulfophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]carbamoylamino]-4-oxonaphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1ccc2c(c1)C=C(S(=O)(=O)O)C(=NNc1ccccc1O)C2=O)Nc1ccc2c(c1)C=C(S(=O)(=O)O)C(=NNc1cc(S(=O)(=O)O)ccc1O)C2=O |
| InChI | InChI=1S/C33H24N6O14S3/c40-25-4-2-1-3-23(25)36-38-29-27(55(48,49)50)13-16-11-18(5-8-21(16)31(29)42)34-33(44)35-19-6-9-22-17(12-19)14-28(56(51,52)53)30(32(22)43)39-37-24-15-20(54(45,46)47)7-10-26(24)41/h1-15,36-37,40-41H,(H2,34,35,44)(H,45,46,47)(H,48,49,50)(H,51,52,53) |
| InChIKey | WUJJYHIKNPFHDX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 327.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|