C34H26N4O8S2 — CID 6848418
3-[[3-methyl-4-[2-methyl-4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid (PubChem CID 6848418) has the molecular formula C34H26N4O8S2 and a molecular weight of 682.74 g/mol. Its IUPAC name is 3-[[3-methyl-4-[2-methyl-4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[[3-methyl-4-[2-methyl-4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 6848418 |
| Molecular Formula | C34H26N4O8S2 |
| Molecular Weight | 682.74 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | 3-[[3-methyl-4-[2-methyl-4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(NN=C2C(=O)c3ccc(S(=O)(=O)O)cc3C=C2S(=O)(=O)O)ccc1-c1ccc(NN=C2C(=O)C=Cc3ccccc32)cc1C |
| InChI | InChI=1S/C34H26N4O8S2/c1-19-15-23(35-37-32-28-6-4-3-5-21(28)7-14-30(32)39)8-11-26(19)27-12-9-24(16-20(27)2)36-38-33-31(48(44,45)46)18-22-17-25(47(41,42)43)10-13-29(22)34(33)40/h3-18,35-36H,1-2H3,(H,41,42,43)(H,44,45,46) |
| InChIKey | ZWUYWBGXNHBLDG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|