C34H24N4NaO14S4 — CID 6330896
CID 6330896 (PubChem CID 6330896) has the molecular formula C34H24N4NaO14S4 and a molecular weight of 863.84 g/mol.
| Compound Name | CID 6330896 |
|---|---|
| PubChem CID | 6330896 |
| Molecular Formula | C34H24N4NaO14S4 |
| Molecular Weight | 863.84 g/mol |
| Exact Mass | 863.01 |
| IUPAC Name | — |
| SMILES | O=C1C=Cc2cc(S(=O)(=O)O)ccc2C1=NNc1ccc(C=Cc2ccc(NN=C3C(=O)C=Cc4cc(S(=O)(=O)O)ccc43)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na] |
| InChI | InChI=1S/C34H24N4O14S4.Na/c39-29-13-5-21-15-25(53(41,42)43)9-11-27(21)33(29)37-35-23-7-3-19(31(17-23)55(47,48)49)1-2-20-4-8-24(18-32(20)56(50,51)52)36-38-34-28-12-10-26(54(44,45)46)16-22(28)6-14-30(34)40;/h1-18,35-36H,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52); |
| InChIKey | OMKYKFMDGNTKPH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 300.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|