C32H22N6O8S2 — CID 16728316
5-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-[(E)-2-[4-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 16728316) has the molecular formula C32H22N6O8S2 and a molecular weight of 682.70 g/mol. Its IUPAC name is 5-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-[(E)-2-[4-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-[(E)-2-[4-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 16728316 |
| Molecular Formula | C32H22N6O8S2 |
| Molecular Weight | 682.70 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | 5-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-[(E)-2-[4-[(2Z)-2-(8-oxoquinolin-7-ylidene)hydrazinyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=C1/C(=N\Nc2ccc(/C=C/c3ccc(N/N=C4/C=Cc5cccnc5C4=O)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)C=Cc2cccnc21 |
| InChI | InChI=1S/C32H22N6O8S2/c39-31-25(13-9-21-3-1-15-33-29(21)31)37-35-23-11-7-19(27(17-23)47(41,42)43)5-6-20-8-12-24(18-28(20)48(44,45)46)36-38-26-14-10-22-4-2-16-34-30(22)32(26)40/h1-18,35-36H,(H,41,42,43)(H,44,45,46)/b6-5+,37-25-,38-26- |
| InChIKey | HGJMQPMHFCDIRH-HZUGNXFESA-N |
| XLogP | 4.50 |
| TPSA | 217.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|